C9H16N2 — CID 90945235
N-(ethylideneamino)-N-methylhexa-2,4-dien-2-amine (PubChem CID 90945235) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is N-(ethylideneamino)-N-methylhexa-2,4-dien-2-amine.
| Compound Name | N-(ethylideneamino)-N-methylhexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 90945235 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N-(ethylideneamino)-N-methylhexa-2,4-dien-2-amine |
| SMILES | CC=CC=C(C)N(C)N=CC |
| InChI | InChI=1S/C9H16N2/c1-5-7-8-9(3)11(4)10-6-2/h5-8H,1-4H3 |
| InChIKey | YCLLKIOGSIILAT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|