C20H18O6 — CID 90945251
2-(3,4-dihydroxynaphthalen-1-yl)-3-methoxy-3,4-dihydro-2H-chromene-5,7-diol (PubChem CID 90945251) has the molecular formula C20H18O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is 2-(3,4-dihydroxynaphthalen-1-yl)-3-methoxy-3,4-dihydro-2H-chromene-5,7-diol.
| Compound Name | 2-(3,4-dihydroxynaphthalen-1-yl)-3-methoxy-3,4-dihydro-2H-chromene-5,7-diol |
|---|---|
| PubChem CID | 90945251 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-(3,4-dihydroxynaphthalen-1-yl)-3-methoxy-3,4-dihydro-2H-chromene-5,7-diol |
| SMILES | COC1Cc2c(O)cc(O)cc2OC1c1cc(O)c(O)c2ccccc12 |
| InChI | InChI=1S/C20H18O6/c1-25-18-9-14-15(22)6-10(21)7-17(14)26-20(18)13-8-16(23)19(24)12-5-3-2-4-11(12)13/h2-8,18,20-24H,9H2,1H3 |
| InChIKey | JECRQRFJECYDOQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|