C20H16O9 — CID 101409819
3,4,5,6-tetrahydroxy-1-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]benzo[7]annulen-7-one (PubChem CID 101409819) has the molecular formula C20H16O9 and a molecular weight of 400.34 g/mol. Its IUPAC name is 3,4,5,6-tetrahydroxy-1-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]benzo[7]annulen-7-one.
| Compound Name | 3,4,5,6-tetrahydroxy-1-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]benzo[7]annulen-7-one |
|---|---|
| PubChem CID | 101409819 |
| Molecular Formula | C20H16O9 |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 3,4,5,6-tetrahydroxy-1-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]benzo[7]annulen-7-one |
| SMILES | O=c1ccc2c([C@H]3Oc4cc(O)cc(O)c4C[C@H]3O)cc(O)c(O)c2c(O)c1O |
| InChI | InChI=1S/C20H16O9/c21-7-3-12(23)10-6-14(25)20(29-15(10)4-7)9-5-13(24)17(26)16-8(9)1-2-11(22)18(27)19(16)28/h1-5,14,20-21,23-26H,6H2,(H2,22,27,28)/t14-,20-/m1/s1 |
| InChIKey | PAZLMBFGTOCIIJ-JLTOFOAXSA-N |
| XLogP | 1.47 |
| TPSA | 167.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|