C15H13FO6 — CID 86271355
(2R,3R)-2-(2-fluoro-4,5-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol (PubChem CID 86271355) has the molecular formula C15H13FO6 and a molecular weight of 308.26 g/mol. Its IUPAC name is (2R,3R)-2-(2-fluoro-4,5-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol.
| Compound Name | (2R,3R)-2-(2-fluoro-4,5-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
|---|---|
| PubChem CID | 86271355 |
| Molecular Formula | C15H13FO6 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | (2R,3R)-2-(2-fluoro-4,5-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| SMILES | Oc1cc(O)c2c(c1)O[C@H](c1cc(O)c(O)cc1F)[C@H](O)C2 |
| InChI | InChI=1S/C15H13FO6/c16-9-5-12(20)11(19)3-7(9)15-13(21)4-8-10(18)1-6(17)2-14(8)22-15/h1-3,5,13,15,17-21H,4H2/t13-,15-/m1/s1 |
| InChIKey | PTWMSYBKQILGKW-UKRRQHHQSA-N |
| XLogP | 1.69 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|