C27H22O11 — CID 101458353
8-hydroxy-4,6-bis[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]chromen-2-one (PubChem CID 101458353) has the molecular formula C27H22O11 and a molecular weight of 522.46 g/mol. Its IUPAC name is 8-hydroxy-4,6-bis[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]chromen-2-one.
| Compound Name | 8-hydroxy-4,6-bis[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]chromen-2-one |
|---|---|
| PubChem CID | 101458353 |
| Molecular Formula | C27H22O11 |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | 8-hydroxy-4,6-bis[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]chromen-2-one |
| SMILES | O=c1cc([C@H]2Oc3cc(O)cc(O)c3C[C@H]2O)c2cc([C@H]3Oc4cc(O)cc(O)c4C[C@H]3O)cc(O)c2o1 |
| InChI | InChI=1S/C27H22O11/c28-11-3-17(30)15-7-20(33)25(36-22(15)5-11)10-1-13-14(9-24(35)38-27(13)19(32)2-10)26-21(34)8-16-18(31)4-12(29)6-23(16)37-26/h1-6,9,20-21,25-26,28-34H,7-8H2/t20-,21-,25-,26-/m1/s1 |
| InChIKey | CNPZRHCYJIAHJM-FJIJVGMHSA-N |
| XLogP | 2.40 |
| TPSA | 190.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|