C24H26N6O2 — CID 90945810
(3S,5S)-2-[(2S)-2-amino-3-[(1S,4S)-5-[(1R)-5-isocyano-2,3-dihydro-1H-inden-1-yl]-6-oxo-2,5-diazabicyclo[2.2.1]heptan-2-yl]propanoyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile (PubChem CID 90945810) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is (3S,5S)-2-[(2S)-2-amino-3-[(1S,4S)-5-[(1R)-5-isocyano-2,3-dihydro-1H-inden-1-yl]-6-oxo-2,5-diazabicyclo[2.2.1]heptan-2-yl]propanoyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile.
| Compound Name | (3S,5S)-2-[(2S)-2-amino-3-[(1S,4S)-5-[(1R)-5-isocyano-2,3-dihydro-1H-inden-1-yl]-6-oxo-2,5-diazabicyclo[2.2.1]heptan-2-yl]propanoyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile |
|---|---|
| PubChem CID | 90945810 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (3S,5S)-2-[(2S)-2-amino-3-[(1S,4S)-5-[(1R)-5-isocyano-2,3-dihydro-1H-inden-1-yl]-6-oxo-2,5-diazabicyclo[2.2.1]heptan-2-yl]propanoyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)CC[C@H]2N1C(=O)[C@@H]2C[C@H]1CN2C[C@H](N)C(=O)N1C2C[C@H]2C[C@H]1C#N |
| InChI | InChI=1S/C24H26N6O2/c1-27-15-3-4-18-13(6-15)2-5-20(18)30-17-9-22(24(30)32)28(11-17)12-19(26)23(31)29-16(10-25)7-14-8-21(14)29/h3-4,6,14,16-17,19-22H,2,5,7-9,11-12,26H2/t14-,16+,17+,19+,20-,21?,22+/m1/s1 |
| InChIKey | SLIXYTZHFZUAQM-FZRUSQKFSA-N |
| XLogP | 1.35 |
| TPSA | 98.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|