C30H29FN6O5S — CID 90946647
3-[2-(4-benzoylpiperazin-1-yl)-1-[(4-methylphenyl)sulfonyldiazenyl]-2-oxoethyl]-4-fluoro-N-methyl-1H-indole-7-carboxamide (PubChem CID 90946647) has the molecular formula C30H29FN6O5S and a molecular weight of 604.66 g/mol. Its IUPAC name is 3-[2-(4-benzoylpiperazin-1-yl)-1-[(4-methylphenyl)sulfonyldiazenyl]-2-oxoethyl]-4-fluoro-N-methyl-1H-indole-7-carboxamide.
| Compound Name | 3-[2-(4-benzoylpiperazin-1-yl)-1-[(4-methylphenyl)sulfonyldiazenyl]-2-oxoethyl]-4-fluoro-N-methyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 90946647 |
| Molecular Formula | C30H29FN6O5S |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.19 |
| IUPAC Name | 3-[2-(4-benzoylpiperazin-1-yl)-1-[(4-methylphenyl)sulfonyldiazenyl]-2-oxoethyl]-4-fluoro-N-methyl-1H-indole-7-carboxamide |
| SMILES | CNC(=O)c1ccc(F)c2c(C(/N=N/S(=O)(=O)c3ccc(C)cc3)C(=O)N3CCN(C(=O)c4ccccc4)CC3)c[nH]c12 |
| InChI | InChI=1S/C30H29FN6O5S/c1-19-8-10-21(11-9-19)43(41,42)35-34-27(23-18-33-26-22(28(38)32-2)12-13-24(31)25(23)26)30(40)37-16-14-36(15-17-37)29(39)20-6-4-3-5-7-20/h3-13,18,27,33H,14-17H2,1-2H3,(H,32,38)/b35-34+ |
| InChIKey | ZQRHCRNAVRRXGV-XAHDOWKMSA-N |
| XLogP | 3.84 |
| TPSA | 144.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|