C27H30FN5O — CID 143126584
[4-[3-[[4-fluoro-7-[1-(2-methylhydrazinyl)ethenyl]-1H-indol-3-yl]methyl]buta-1,3-dien-2-yl]piperazin-1-yl]-phenylmethanone (PubChem CID 143126584) has the molecular formula C27H30FN5O and a molecular weight of 459.57 g/mol. Its IUPAC name is [4-[3-[[4-fluoro-7-[1-(2-methylhydrazinyl)ethenyl]-1H-indol-3-yl]methyl]buta-1,3-dien-2-yl]piperazin-1-yl]-phenylmethanone.
| Compound Name | [4-[3-[[4-fluoro-7-[1-(2-methylhydrazinyl)ethenyl]-1H-indol-3-yl]methyl]buta-1,3-dien-2-yl]piperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 143126584 |
| Molecular Formula | C27H30FN5O |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | [4-[3-[[4-fluoro-7-[1-(2-methylhydrazinyl)ethenyl]-1H-indol-3-yl]methyl]buta-1,3-dien-2-yl]piperazin-1-yl]-phenylmethanone |
| SMILES | C=C(Cc1c[nH]c2c(C(=C)NNC)ccc(F)c12)C(=C)N1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H30FN5O/c1-18(16-22-17-30-26-23(19(2)31-29-4)10-11-24(28)25(22)26)20(3)32-12-14-33(15-13-32)27(34)21-8-6-5-7-9-21/h5-11,17,29-31H,1-3,12-16H2,4H3 |
| InChIKey | IFLXPCPFHRNPMF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|