C21H32 — CID 90947304
3-(3-cyclohex-3-en-1-yl-2-cyclohexylprop-2-enyl)cyclohexene (PubChem CID 90947304) has the molecular formula C21H32 and a molecular weight of 284.49 g/mol. Its IUPAC name is 3-(3-cyclohex-3-en-1-yl-2-cyclohexylprop-2-enyl)cyclohexene.
| Compound Name | 3-(3-cyclohex-3-en-1-yl-2-cyclohexylprop-2-enyl)cyclohexene |
|---|---|
| PubChem CID | 90947304 |
| Molecular Formula | C21H32 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 3-(3-cyclohex-3-en-1-yl-2-cyclohexylprop-2-enyl)cyclohexene |
| SMILES | C1=CC(CC(=CC2CC=CCC2)C2CCCCC2)CCC1 |
| InChI | InChI=1S/C21H32/c1-4-10-18(11-5-1)16-21(20-14-8-3-9-15-20)17-19-12-6-2-7-13-19/h1,4,6,12,16,18-20H,2-3,5,7-11,13-15,17H2 |
| InChIKey | ZGNFPKKEPGOULN-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|