C24H27FN4O2 — CID 90947329
2-[3-[7-[2-(4-fluorophenyl)-2-oxoethyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]propylamino]benzonitrile (PubChem CID 90947329) has the molecular formula C24H27FN4O2 and a molecular weight of 422.50 g/mol. Its IUPAC name is 2-[3-[7-[2-(4-fluorophenyl)-2-oxoethyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]propylamino]benzonitrile.
| Compound Name | 2-[3-[7-[2-(4-fluorophenyl)-2-oxoethyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]propylamino]benzonitrile |
|---|---|
| PubChem CID | 90947329 |
| Molecular Formula | C24H27FN4O2 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 2-[3-[7-[2-(4-fluorophenyl)-2-oxoethyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]propylamino]benzonitrile |
| SMILES | N#Cc1ccccc1NCCCN1CC2CN(CC(=O)c3ccc(F)cc3)CC(C1)O2 |
| InChI | InChI=1S/C24H27FN4O2/c25-20-8-6-18(7-9-20)24(30)17-29-15-21-13-28(14-22(16-29)31-21)11-3-10-27-23-5-2-1-4-19(23)12-26/h1-2,4-9,21-22,27H,3,10-11,13-17H2 |
| InChIKey | FWLVVKACPZWZEZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|