C16H18N4O — CID 90947512
4-(4-methoxyphenyl)-3-methylquinazoline-2,4-diamine (PubChem CID 90947512) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3-methylquinazoline-2,4-diamine.
| Compound Name | 4-(4-methoxyphenyl)-3-methylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 90947512 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-(4-methoxyphenyl)-3-methylquinazoline-2,4-diamine |
| SMILES | COc1ccc(C2(N)c3ccccc3N=C(N)N2C)cc1 |
| InChI | InChI=1S/C16H18N4O/c1-20-15(17)19-14-6-4-3-5-13(14)16(20,18)11-7-9-12(21-2)10-8-11/h3-10H,18H2,1-2H3,(H2,17,19) |
| InChIKey | XJZQLCURMFRIMF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |