C16H15N3OS — CID 10891824
4-(4-methoxyphenyl)-3-methyl-1H-1,3,5-benzotriazepine-2-thione (PubChem CID 10891824) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3-methyl-1H-1,3,5-benzotriazepine-2-thione.
| Compound Name | 4-(4-methoxyphenyl)-3-methyl-1H-1,3,5-benzotriazepine-2-thione |
|---|---|
| PubChem CID | 10891824 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 4-(4-methoxyphenyl)-3-methyl-1H-1,3,5-benzotriazepine-2-thione |
| SMILES | COc1ccc(C2=Nc3ccccc3NC(=S)N2C)cc1 |
| InChI | InChI=1S/C16H15N3OS/c1-19-15(11-7-9-12(20-2)10-8-11)17-13-5-3-4-6-14(13)18-16(19)21/h3-10H,1-2H3,(H,18,21) |
| InChIKey | ZWLCWPIODBSIEM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|