C27H32N2O2 — CID 90949268
1-(4-pentylphenyl)-3-(3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl)prop-2-en-1-one (PubChem CID 90949268) has the molecular formula C27H32N2O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 1-(4-pentylphenyl)-3-(3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl)prop-2-en-1-one.
| Compound Name | 1-(4-pentylphenyl)-3-(3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 90949268 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 1-(4-pentylphenyl)-3-(3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl)prop-2-en-1-one |
| SMILES | CCCCCc1ccc(C(=O)C=CN2CCC3(C=C(c4ccccc4)NO3)CC2)cc1 |
| InChI | InChI=1S/C27H32N2O2/c1-2-3-5-8-22-11-13-24(14-12-22)26(30)15-18-29-19-16-27(17-20-29)21-25(28-31-27)23-9-6-4-7-10-23/h4,6-7,9-15,18,21,28H,2-3,5,8,16-17,19-20H2,1H3 |
| InChIKey | NSADMDBKHIBTTH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|