C32H38N2O4Si — CID 90950013
(4-anilinophenyl)methanol;N-phenyl-4-(4-trimethoxysilylbut-1-enyl)aniline (PubChem CID 90950013) has the molecular formula C32H38N2O4Si and a molecular weight of 542.75 g/mol. Its IUPAC name is (4-anilinophenyl)methanol;N-phenyl-4-(4-trimethoxysilylbut-1-enyl)aniline.
| Compound Name | (4-anilinophenyl)methanol;N-phenyl-4-(4-trimethoxysilylbut-1-enyl)aniline |
|---|---|
| PubChem CID | 90950013 |
| Molecular Formula | C32H38N2O4Si |
| Molecular Weight | 542.75 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | (4-anilinophenyl)methanol;N-phenyl-4-(4-trimethoxysilylbut-1-enyl)aniline |
| SMILES | CO[Si](CCC=Cc1ccc(Nc2ccccc2)cc1)(OC)OC.OCc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C19H25NO3Si.C13H13NO/c1-21-24(22-2,23-3)16-8-7-9-17-12-14-19(15-13-17)20-18-10-5-4-6-11-18;15-10-11-6-8-13(9-7-11)14-12-4-2-1-3-5-12/h4-7,9-15,20H,8,16H2,1-3H3;1-9,14-15H,10H2 |
| InChIKey | XCMCCNMIELGIIZ-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 71.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.75 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|