C22H38O3Si4 — CID 68658116
tris[[ethenyl(dimethyl)silyl]oxy]-(4-phenylbut-3-enyl)silane (PubChem CID 68658116) has the molecular formula C22H38O3Si4 and a molecular weight of 462.89 g/mol. Its IUPAC name is tris[[ethenyl(dimethyl)silyl]oxy]-(4-phenylbut-3-enyl)silane.
| Compound Name | tris[[ethenyl(dimethyl)silyl]oxy]-(4-phenylbut-3-enyl)silane |
|---|---|
| PubChem CID | 68658116 |
| Molecular Formula | C22H38O3Si4 |
| Molecular Weight | 462.89 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | tris[[ethenyl(dimethyl)silyl]oxy]-(4-phenylbut-3-enyl)silane |
| SMILES | C=C[Si](C)(C)O[Si](CCC=Cc1ccccc1)(O[Si](C)(C)C=C)O[Si](C)(C)C=C |
| InChI | InChI=1S/C22H38O3Si4/c1-10-26(4,5)23-29(24-27(6,7)11-2,25-28(8,9)12-3)21-17-16-20-22-18-14-13-15-19-22/h10-16,18-20H,1-3,17,21H2,4-9H3 |
| InChIKey | BELGIKHBLXIJEG-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.89 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|