C19H32O2Si3 — CID 123564848
ethenyl-[[ethenyl(dimethyl)silyl]oxy-(4-phenylbut-3-enylsilyl)methoxy]-dimethylsilane (PubChem CID 123564848) has the molecular formula C19H32O2Si3 and a molecular weight of 376.72 g/mol. Its IUPAC name is ethenyl-[[ethenyl(dimethyl)silyl]oxy-(4-phenylbut-3-enylsilyl)methoxy]-dimethylsilane.
| Compound Name | ethenyl-[[ethenyl(dimethyl)silyl]oxy-(4-phenylbut-3-enylsilyl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 123564848 |
| Molecular Formula | C19H32O2Si3 |
| Molecular Weight | 376.72 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | ethenyl-[[ethenyl(dimethyl)silyl]oxy-(4-phenylbut-3-enylsilyl)methoxy]-dimethylsilane |
| SMILES | C=C[Si](C)(C)OC(O[Si](C)(C)C=C)[SiH2]CCC=Cc1ccccc1 |
| InChI | InChI=1S/C19H32O2Si3/c1-7-23(3,4)20-19(21-24(5,6)8-2)22-17-13-12-16-18-14-10-9-11-15-18/h7-12,14-16,19H,1-2,13,17,22H2,3-6H3 |
| InChIKey | XSJINWBCWQCVRC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.72 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|