C30H48N2O3 — CID 90951467
2-butoxy-N,N-dibutyl-5-methylaniline;2-(2-methylpropoxy)benzamide (PubChem CID 90951467) has the molecular formula C30H48N2O3 and a molecular weight of 484.73 g/mol. Its IUPAC name is 2-butoxy-N,N-dibutyl-5-methylaniline;2-(2-methylpropoxy)benzamide.
| Compound Name | 2-butoxy-N,N-dibutyl-5-methylaniline;2-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 90951467 |
| Molecular Formula | C30H48N2O3 |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.37 |
| IUPAC Name | 2-butoxy-N,N-dibutyl-5-methylaniline;2-(2-methylpropoxy)benzamide |
| SMILES | CC(C)COc1ccccc1C(N)=O.CCCCOc1ccc(C)cc1N(CCCC)CCCC |
| InChI | InChI=1S/C19H33NO.C11H15NO2/c1-5-8-13-20(14-9-6-2)18-16-17(4)11-12-19(18)21-15-10-7-3;1-8(2)7-14-10-6-4-3-5-9(10)11(12)13/h11-12,16H,5-10,13-15H2,1-4H3;3-6,8H,7H2,1-2H3,(H2,12,13) |
| InChIKey | OUQUYKWBMJJKFX-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|