2,4-dihydroxy-3-iodonaphthalene-1-carboxylic acid

C11H7IO4 — CID 90954227

IUPAC2,4-dihydroxy-3-iodonaphthalene-1-carboxylic acid
SMILESO=C(O)c1c(O)c(I)c(O)c2ccccc12
InChIInChI=1S/C11H7IO4/c12-8-9(13)6-4-2-1-3-5(6)7(10(8)14)11(15)16/h1-4,13-14H,(H,15,16)
InChIKeyDDFLJYSBFIWFGO-UHFFFAOYSA-N
MW330.08 g/mol
LogP2.55
Rot. Bonds1

About 2,4-dihydroxy-3-iodonaphthalene-1-carboxylic acid

2,4-dihydroxy-3-iodonaphthalene-1-carboxylic acid (PubChem CID 90954227) has the molecular formula C11H7IO4 and a molecular weight of 330.08 g/mol. Its IUPAC name is 2,4-dihydroxy-3-iodonaphthalene-1-carboxylic acid.

Molecular Properties

Compound Name2,4-dihydroxy-3-iodonaphthalene-1-carboxylic acid
PubChem CID90954227
Molecular FormulaC11H7IO4
Molecular Weight330.08 g/mol
Exact Mass329.94
IUPAC Name2,4-dihydroxy-3-iodonaphthalene-1-carboxylic acid
SMILESO=C(O)c1c(O)c(I)c(O)c2ccccc12
InChIInChI=1S/C11H7IO4/c12-8-9(13)6-4-2-1-3-5(6)7(10(8)14)11(15)16/h1-4,13-14H,(H,15,16)
InChIKeyDDFLJYSBFIWFGO-UHFFFAOYSA-N
XLogP2.55
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500330.08
LogP ≤ 52.55
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 2,4-dihydroxy-3-iodonaphthalene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dihydroxy-3-iodonaphthalene-1-carboxylic acid?
The IUPAC name of 2,4-dihydroxy-3-iodonaphthalene-1-carboxylic acid (CID 90954227) is 2,4-dihydroxy-3-iodonaphthalene-1-carboxylic acid.
What is the SMILES notation for 2,4-dihydroxy-3-iodonaphthalene-1-carboxylic acid?
The canonical SMILES for 2,4-dihydroxy-3-iodonaphthalene-1-carboxylic acid is O=C(O)c1c(O)c(I)c(O)c2ccccc12.
What is the InChIKey of 2,4-dihydroxy-3-iodonaphthalene-1-carboxylic acid?
The InChIKey is DDFLJYSBFIWFGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7IO4/c12-8-9(13)6-4-2-1-3-5(6)7(10(8)14)11(15)16/h1-4,13-14H,(H,15,16).
What are the key properties of 2,4-dihydroxy-3-iodonaphthalene-1-carboxylic acid?
2,4-dihydroxy-3-iodonaphthalene-1-carboxylic acid has a molecular weight of 330.08 g/mol, XLogP of 2.55, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydroxy-3-iodonaphthalene-1-carboxylic acid is sourced from PubChem (CID 90954227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).