C10H9BrFNO4S — CID 90954347
[3-(4-bromo-3-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl] methanesulfonate (PubChem CID 90954347) has the molecular formula C10H9BrFNO4S and a molecular weight of 338.15 g/mol. Its IUPAC name is [3-(4-bromo-3-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl] methanesulfonate.
| Compound Name | [3-(4-bromo-3-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl] methanesulfonate |
|---|---|
| PubChem CID | 90954347 |
| Molecular Formula | C10H9BrFNO4S |
| Molecular Weight | 338.15 g/mol |
| Exact Mass | 336.94 |
| IUPAC Name | [3-(4-bromo-3-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1C=C(c2ccc(Br)c(F)c2)NO1 |
| InChI | InChI=1S/C10H9BrFNO4S/c1-18(14,15)17-10-5-9(13-16-10)6-2-3-7(11)8(12)4-6/h2-5,10,13H,1H3 |
| InChIKey | DNOFLFAEGDNMQN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.15 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|