C10H9BrFNO4S — CID 91190401
[3-(4-bromo-3-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanesulfonic acid (PubChem CID 91190401) has the molecular formula C10H9BrFNO4S and a molecular weight of 338.15 g/mol. Its IUPAC name is [3-(4-bromo-3-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanesulfonic acid.
| Compound Name | [3-(4-bromo-3-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 91190401 |
| Molecular Formula | C10H9BrFNO4S |
| Molecular Weight | 338.15 g/mol |
| Exact Mass | 336.94 |
| IUPAC Name | [3-(4-bromo-3-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanesulfonic acid |
| SMILES | O=S(=O)(O)CC1C=C(c2ccc(Br)c(F)c2)NO1 |
| InChI | InChI=1S/C10H9BrFNO4S/c11-8-2-1-6(3-9(8)12)10-4-7(17-13-10)5-18(14,15)16/h1-4,7,13H,5H2,(H,14,15,16) |
| InChIKey | KBECRKVAFYICPN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.15 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|