About 1-O-ethyl 5-O-methyl 2-(2-methylpropanimidoyl)pent-2-enedioate
1-O-ethyl 5-O-methyl 2-(2-methylpropanimidoyl)pent-2-enedioate (PubChem CID 90954526) has the molecular formula C12H19NO4
and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-O-ethyl 5-O-methyl 2-(2-methylpropanimidoyl)pent-2-enedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 5-O-methyl 2-(2-methylpropanimidoyl)pent-2-enedioate |
| PubChem CID | 90954526 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 1-O-ethyl 5-O-methyl 2-(2-methylpropanimidoyl)pent-2-enedioate |
| SMILES | [H]/N=C(/C(=CCC(=O)OC)C(=O)OCC)C(C)C |
| InChI | InChI=1S/C12H19NO4/c1-5-17-12(15)9(11(13)8(2)3)6-7-10(14)16-4/h6,8,13H,5,7H2,1-4H3/b9-6?,13-11+ |
| InChIKey | VWZPCDZKNUABAS-WASVPAFCSA-N |
| XLogP | 1.71 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 5-O-methyl 2-(2-methylpropanimidoyl)pent-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 5-O-methyl 2-(2-methylpropanimidoyl)pent-2-enedioate?
The IUPAC name of 1-O-ethyl 5-O-methyl 2-(2-methylpropanimidoyl)pent-2-enedioate (CID 90954526) is 1-O-ethyl 5-O-methyl 2-(2-methylpropanimidoyl)pent-2-enedioate.
What is the SMILES notation for 1-O-ethyl 5-O-methyl 2-(2-methylpropanimidoyl)pent-2-enedioate?
The canonical SMILES for 1-O-ethyl 5-O-methyl 2-(2-methylpropanimidoyl)pent-2-enedioate is [H]/N=C(/C(=CCC(=O)OC)C(=O)OCC)C(C)C.
What is the InChIKey of 1-O-ethyl 5-O-methyl 2-(2-methylpropanimidoyl)pent-2-enedioate?
The InChIKey is VWZPCDZKNUABAS-WASVPAFCSA-N. The full InChI is InChI=1S/C12H19NO4/c1-5-17-12(15)9(11(13)8(2)3)6-7-10(14)16-4/h6,8,13H,5,7H2,1-4H3/b9-6?,13-11+.
What are the key properties of 1-O-ethyl 5-O-methyl 2-(2-methylpropanimidoyl)pent-2-enedioate?
1-O-ethyl 5-O-methyl 2-(2-methylpropanimidoyl)pent-2-enedioate has a molecular weight of 241.29 g/mol, XLogP of 1.71, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 5-O-methyl 2-(2-methylpropanimidoyl)pent-2-enedioate is sourced from PubChem (CID 90954526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).