About 5-O-ethyl 1-O-methyl 4-ethanimidoylpent-2-enedioate
5-O-ethyl 1-O-methyl 4-ethanimidoylpent-2-enedioate (PubChem CID 90903833) has the molecular formula C10H15NO4
and a molecular weight of 213.23 g/mol. Its IUPAC name is 5-O-ethyl 1-O-methyl 4-ethanimidoylpent-2-enedioate.
Molecular Properties
| Compound Name | 5-O-ethyl 1-O-methyl 4-ethanimidoylpent-2-enedioate |
| PubChem CID | 90903833 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 5-O-ethyl 1-O-methyl 4-ethanimidoylpent-2-enedioate |
| SMILES | [H]/N=C(\C)C(C=CC(=O)OC)C(=O)OCC |
| InChI | InChI=1S/C10H15NO4/c1-4-15-10(13)8(7(2)11)5-6-9(12)14-3/h5-6,8,11H,4H2,1-3H3/b6-5?,11-7+ |
| InChIKey | HMXITCIJEAFIQJ-OIGRYENSSA-N |
| XLogP | 0.93 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-O-ethyl 1-O-methyl 4-ethanimidoylpent-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-ethyl 1-O-methyl 4-ethanimidoylpent-2-enedioate?
The IUPAC name of 5-O-ethyl 1-O-methyl 4-ethanimidoylpent-2-enedioate (CID 90903833) is 5-O-ethyl 1-O-methyl 4-ethanimidoylpent-2-enedioate.
What is the SMILES notation for 5-O-ethyl 1-O-methyl 4-ethanimidoylpent-2-enedioate?
The canonical SMILES for 5-O-ethyl 1-O-methyl 4-ethanimidoylpent-2-enedioate is [H]/N=C(\C)C(C=CC(=O)OC)C(=O)OCC.
What is the InChIKey of 5-O-ethyl 1-O-methyl 4-ethanimidoylpent-2-enedioate?
The InChIKey is HMXITCIJEAFIQJ-OIGRYENSSA-N. The full InChI is InChI=1S/C10H15NO4/c1-4-15-10(13)8(7(2)11)5-6-9(12)14-3/h5-6,8,11H,4H2,1-3H3/b6-5?,11-7+.
What are the key properties of 5-O-ethyl 1-O-methyl 4-ethanimidoylpent-2-enedioate?
5-O-ethyl 1-O-methyl 4-ethanimidoylpent-2-enedioate has a molecular weight of 213.23 g/mol, XLogP of 0.93, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-ethyl 1-O-methyl 4-ethanimidoylpent-2-enedioate is sourced from PubChem (CID 90903833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).