C9H9NO4 — CID 7925521
ethyl (Z)-3-[(1R)-2-imino-3,4-dioxocyclobutyl]prop-2-enoate (PubChem CID 7925521) has the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. Its IUPAC name is ethyl (Z)-3-[(1R)-2-imino-3,4-dioxocyclobutyl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[(1R)-2-imino-3,4-dioxocyclobutyl]prop-2-enoate |
|---|---|
| PubChem CID | 7925521 |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | ethyl (Z)-3-[(1R)-2-imino-3,4-dioxocyclobutyl]prop-2-enoate |
| SMILES | [H]/N=C1\C(=O)C(=O)[C@@H]1/C=C\C(=O)OCC |
| InChI | InChI=1S/C9H9NO4/c1-2-14-6(11)4-3-5-7(10)9(13)8(5)12/h3-5,10H,2H2,1H3/b4-3-,10-7-/t5-/m1/s1 |
| InChIKey | FHTCTVVNPTVFHD-HKPOMECOSA-N |
| XLogP | -0.11 |
| TPSA | 84.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|