C27H19ClN2O5S2 — CID 90955484
5-[[4-[(2-chloro-1,3-oxathiol-4-yl)methoxy]phenyl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 90955484) has the molecular formula C27H19ClN2O5S2 and a molecular weight of 551.05 g/mol. Its IUPAC name is 5-[[4-[(2-chloro-1,3-oxathiol-4-yl)methoxy]phenyl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[4-[(2-chloro-1,3-oxathiol-4-yl)methoxy]phenyl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 90955484 |
| Molecular Formula | C27H19ClN2O5S2 |
| Molecular Weight | 551.05 g/mol |
| Exact Mass | 550.04 |
| IUPAC Name | 5-[[4-[(2-chloro-1,3-oxathiol-4-yl)methoxy]phenyl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)N(c2ccc(Oc3ccccc3)cc2)C(=O)C1=Cc1ccc(OCC2=COC(Cl)S2)cc1 |
| InChI | InChI=1S/C27H19ClN2O5S2/c28-26-34-16-22(37-26)15-33-19-10-6-17(7-11-19)14-23-24(31)29-27(36)30(25(23)32)18-8-12-21(13-9-18)35-20-4-2-1-3-5-20/h1-14,16,26H,15H2,(H,29,31,36) |
| InChIKey | YNGYGJAEEPIBFR-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.05 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|