C34H24N4O4S2 — CID 91311930
5-[[4-[(1-benzyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 91311930) has the molecular formula C34H24N4O4S2 and a molecular weight of 616.72 g/mol. Its IUPAC name is 5-[[4-[(1-benzyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[4-[(1-benzyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 91311930 |
| Molecular Formula | C34H24N4O4S2 |
| Molecular Weight | 616.72 g/mol |
| Exact Mass | 616.12 |
| IUPAC Name | 5-[[4-[(1-benzyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)N(c2ccc(Oc3ccccc3)cc2)C(=O)C1=Cc1ccc(C=C2NC(=S)N(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C34H24N4O4S2/c39-30-28(31(40)38(34(44)36-30)25-15-17-27(18-16-25)42-26-9-5-2-6-10-26)19-22-11-13-23(14-12-22)20-29-32(41)37(33(43)35-29)21-24-7-3-1-4-8-24/h1-20H,21H2,(H,35,43)(H,36,39,44) |
| InChIKey | KQUYMZNXSHAKOB-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.72 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|