C43H49N3O2 — CID 90956144
N,N-bis(4-hexoxyphenyl)-4-[2-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]ethenyl]aniline (PubChem CID 90956144) has the molecular formula C43H49N3O2 and a molecular weight of 639.88 g/mol. Its IUPAC name is N,N-bis(4-hexoxyphenyl)-4-[2-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]ethenyl]aniline.
| Compound Name | N,N-bis(4-hexoxyphenyl)-4-[2-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]ethenyl]aniline |
|---|---|
| PubChem CID | 90956144 |
| Molecular Formula | C43H49N3O2 |
| Molecular Weight | 639.88 g/mol |
| Exact Mass | 639.38 |
| IUPAC Name | N,N-bis(4-hexoxyphenyl)-4-[2-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]ethenyl]aniline |
| SMILES | CCCCCCOc1ccc(N(c2ccc(C=Cc3ccnc(-c4cc(C)ccn4)c3)cc2)c2ccc(OCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C43H49N3O2/c1-4-6-8-10-30-47-40-22-18-38(19-23-40)46(39-20-24-41(25-21-39)48-31-11-9-7-5-2)37-16-14-35(15-17-37)12-13-36-27-29-45-43(33-36)42-32-34(3)26-28-44-42/h12-29,32-33H,4-11,30-31H2,1-3H3 |
| InChIKey | RZWCLPUUBROJHD-UHFFFAOYSA-N |
| XLogP | 12.01 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.88 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|