C12H25NO4 — CID 90956268
ethane;2-ethyl-4,5-dimethyl-1,3-oxazole;1-hydroperoxy-2-methoxyethane (PubChem CID 90956268) has the molecular formula C12H25NO4 and a molecular weight of 247.33 g/mol. Its IUPAC name is ethane;2-ethyl-4,5-dimethyl-1,3-oxazole;1-hydroperoxy-2-methoxyethane.
| Compound Name | ethane;2-ethyl-4,5-dimethyl-1,3-oxazole;1-hydroperoxy-2-methoxyethane |
|---|---|
| PubChem CID | 90956268 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | ethane;2-ethyl-4,5-dimethyl-1,3-oxazole;1-hydroperoxy-2-methoxyethane |
| SMILES | CC.CCc1nc(C)c(C)o1.COCCOO |
| InChI | InChI=1S/C7H11NO.C3H8O3.C2H6/c1-4-7-8-5(2)6(3)9-7;1-5-2-3-6-4;1-2/h4H2,1-3H3;4H,2-3H2,1H3;1-2H3 |
| InChIKey | JBPPKGDHYDFNIQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|