C24H21Cl2NO — CID 90956304
N-[(2R)-2,3-bis(4-chlorophenyl)propyl]-3-phenylprop-2-enamide (PubChem CID 90956304) has the molecular formula C24H21Cl2NO and a molecular weight of 410.34 g/mol. Its IUPAC name is N-[(2R)-2,3-bis(4-chlorophenyl)propyl]-3-phenylprop-2-enamide.
| Compound Name | N-[(2R)-2,3-bis(4-chlorophenyl)propyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 90956304 |
| Molecular Formula | C24H21Cl2NO |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | N-[(2R)-2,3-bis(4-chlorophenyl)propyl]-3-phenylprop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)NC[C@H](Cc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H21Cl2NO/c25-22-11-6-19(7-12-22)16-21(20-9-13-23(26)14-10-20)17-27-24(28)15-8-18-4-2-1-3-5-18/h1-15,21H,16-17H2,(H,27,28)/t21-/m0/s1 |
| InChIKey | JIZRXHBCJUFHGK-NRFANRHFSA-N |
| XLogP | 6.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|