About 5-oxohexyl 2-fluoro-2-hydroxysulfanylacetate
5-oxohexyl 2-fluoro-2-hydroxysulfanylacetate (PubChem CID 90956562) has the molecular formula C8H13FO4S
and a molecular weight of 224.25 g/mol. Its IUPAC name is 5-oxohexyl 2-fluoro-2-hydroxysulfanylacetate.
Molecular Properties
| Compound Name | 5-oxohexyl 2-fluoro-2-hydroxysulfanylacetate |
| PubChem CID | 90956562 |
| Molecular Formula | C8H13FO4S |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 5-oxohexyl 2-fluoro-2-hydroxysulfanylacetate |
| SMILES | CC(=O)CCCCOC(=O)C(F)SO |
| InChI | InChI=1S/C8H13FO4S/c1-6(10)4-2-3-5-13-8(11)7(9)14-12/h7,12H,2-5H2,1H3 |
| InChIKey | FXBDKJBOCJVWKU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-oxohexyl 2-fluoro-2-hydroxysulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxohexyl 2-fluoro-2-hydroxysulfanylacetate?
The IUPAC name of 5-oxohexyl 2-fluoro-2-hydroxysulfanylacetate (CID 90956562) is 5-oxohexyl 2-fluoro-2-hydroxysulfanylacetate.
What is the SMILES notation for 5-oxohexyl 2-fluoro-2-hydroxysulfanylacetate?
The canonical SMILES for 5-oxohexyl 2-fluoro-2-hydroxysulfanylacetate is CC(=O)CCCCOC(=O)C(F)SO.
What is the InChIKey of 5-oxohexyl 2-fluoro-2-hydroxysulfanylacetate?
The InChIKey is FXBDKJBOCJVWKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13FO4S/c1-6(10)4-2-3-5-13-8(11)7(9)14-12/h7,12H,2-5H2,1H3.
What are the key properties of 5-oxohexyl 2-fluoro-2-hydroxysulfanylacetate?
5-oxohexyl 2-fluoro-2-hydroxysulfanylacetate has a molecular weight of 224.25 g/mol, XLogP of 1.79, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxohexyl 2-fluoro-2-hydroxysulfanylacetate is sourced from PubChem (CID 90956562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).