C7H10O5S — CID 90956990
S-[[(2S,3S,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]methyl] ethanethioate (PubChem CID 90956990) has the molecular formula C7H10O5S and a molecular weight of 206.22 g/mol. Its IUPAC name is S-[[(2S,3S,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]methyl] ethanethioate.
| Compound Name | S-[[(2S,3S,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 90956990 |
| Molecular Formula | C7H10O5S |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | S-[[(2S,3S,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]methyl] ethanethioate |
| SMILES | CC(=O)SC[C@H]1OC(=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H10O5S/c1-3(8)13-2-4-5(9)6(10)7(11)12-4/h4-6,9-10H,2H2,1H3/t4-,5-,6-/m1/s1 |
| InChIKey | YGZWGHNKRUBFNF-HSUXUTPPSA-N |
| XLogP | -1.09 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|