C10H18O8S — CID 16752702
(2R,4S)-5-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-2,3,4-trihydroxypentanoate (PubChem CID 16752702) has the molecular formula C10H18O8S and a molecular weight of 298.31 g/mol. Its IUPAC name is (2R,4S)-5-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-2,3,4-trihydroxypentanoate.
| Compound Name | (2R,4S)-5-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-2,3,4-trihydroxypentanoate |
|---|---|
| PubChem CID | 16752702 |
| Molecular Formula | C10H18O8S |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | (2R,4S)-5-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-2,3,4-trihydroxypentanoate |
| SMILES | O=C([O-])[C@H](O)C(O)[C@H](O)C[S+]1C[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C10H18O8S/c11-1-6-7(14)4(12)2-19(6)3-5(13)8(15)9(16)10(17)18/h4-9,11-16H,1-3H2/t4-,5-,6-,7+,8?,9-,19?/m1/s1 |
| InChIKey | JUKFPHLLHDDGBG-QZVCEAHQSA-N |
| XLogP | -5.47 |
| TPSA | 161.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | -5.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|