C9H18O5S2 — CID 16638221
(2R,3S,4R)-5,5-bis(ethylsulfanyl)-2,3,4-trihydroxypentanoic acid (PubChem CID 16638221) has the molecular formula C9H18O5S2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (2R,3S,4R)-5,5-bis(ethylsulfanyl)-2,3,4-trihydroxypentanoic acid.
| Compound Name | (2R,3S,4R)-5,5-bis(ethylsulfanyl)-2,3,4-trihydroxypentanoic acid |
|---|---|
| PubChem CID | 16638221 |
| Molecular Formula | C9H18O5S2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | (2R,3S,4R)-5,5-bis(ethylsulfanyl)-2,3,4-trihydroxypentanoic acid |
| SMILES | CCSC(SCC)[C@H](O)[C@@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C9H18O5S2/c1-3-15-9(16-4-2)7(12)5(10)6(11)8(13)14/h5-7,9-12H,3-4H2,1-2H3,(H,13,14)/t5-,6+,7+/m0/s1 |
| InChIKey | NTKUIGCNIFXSLW-RRKCRQDMSA-N |
| XLogP | -0.01 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|