C14H28O8S2 — CID 159817533
(1R,2R,3S,4S)-1-(1,3-dithian-2-yl)pentane-1,2,3,4-tetrol;(2R,3S,4S)-2,3,4-trihydroxypentanal (PubChem CID 159817533) has the molecular formula C14H28O8S2 and a molecular weight of 388.50 g/mol. Its IUPAC name is (1R,2R,3S,4S)-1-(1,3-dithian-2-yl)pentane-1,2,3,4-tetrol;(2R,3S,4S)-2,3,4-trihydroxypentanal.
| Compound Name | (1R,2R,3S,4S)-1-(1,3-dithian-2-yl)pentane-1,2,3,4-tetrol;(2R,3S,4S)-2,3,4-trihydroxypentanal |
|---|---|
| PubChem CID | 159817533 |
| Molecular Formula | C14H28O8S2 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (1R,2R,3S,4S)-1-(1,3-dithian-2-yl)pentane-1,2,3,4-tetrol;(2R,3S,4S)-2,3,4-trihydroxypentanal |
| SMILES | C[C@H](O)[C@H](O)[C@@H](O)C=O.C[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)C1SCCCS1 |
| InChI | InChI=1S/C9H18O4S2.C5H10O4/c1-5(10)6(11)7(12)8(13)9-14-3-2-4-15-9;1-3(7)5(9)4(8)2-6/h5-13H,2-4H2,1H3;2-5,7-9H,1H3/t5-,6-,7+,8+;3-,4-,5-/m00/s1 |
| InChIKey | NLUOGQPLTFVXNH-MJVUAAFRSA-N |
| XLogP | -2.07 |
| TPSA | 158.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|