C12H24O10S2 — CID 159598536
(3R,4S,5S,6R)-6-(hydroxymethyl)thiane-2,3,4,5-tetrol;(2R,3R,4S,5R)-2,3,4,6-tetrahydroxy-5-sulfanylhexanal (PubChem CID 159598536) has the molecular formula C12H24O10S2 and a molecular weight of 392.45 g/mol. Its IUPAC name is (3R,4S,5S,6R)-6-(hydroxymethyl)thiane-2,3,4,5-tetrol;(2R,3R,4S,5R)-2,3,4,6-tetrahydroxy-5-sulfanylhexanal.
| Compound Name | (3R,4S,5S,6R)-6-(hydroxymethyl)thiane-2,3,4,5-tetrol;(2R,3R,4S,5R)-2,3,4,6-tetrahydroxy-5-sulfanylhexanal |
|---|---|
| PubChem CID | 159598536 |
| Molecular Formula | C12H24O10S2 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (3R,4S,5S,6R)-6-(hydroxymethyl)thiane-2,3,4,5-tetrol;(2R,3R,4S,5R)-2,3,4,6-tetrahydroxy-5-sulfanylhexanal |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](S)CO.OC[C@H]1SC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/2C6H12O5S/c7-1-2-3(8)4(9)5(10)6(11)12-2;7-1-3(9)5(10)6(11)4(12)2-8/h2-11H,1H2;1,3-6,8-12H,2H2/t2-,3-,4+,5-,6?;3-,4+,5+,6+/m10/s1 |
| InChIKey | MLDWWDLKBOLEND-VDBPQNRRSA-N |
| XLogP | -4.95 |
| TPSA | 199.14 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | -4.95 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|