C11H20O8S — CID 58990949
6-[3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-3,4,5-trihydroxyhexanoate (PubChem CID 58990949) has the molecular formula C11H20O8S and a molecular weight of 312.34 g/mol. Its IUPAC name is 6-[3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-3,4,5-trihydroxyhexanoate.
| Compound Name | 6-[3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-3,4,5-trihydroxyhexanoate |
|---|---|
| PubChem CID | 58990949 |
| Molecular Formula | C11H20O8S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 6-[3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-3,4,5-trihydroxyhexanoate |
| SMILES | O=C([O-])CC(O)C(O)C(O)C[S+]1CC(O)C(O)C1CO |
| InChI | InChI=1S/C11H20O8S/c12-2-8-11(19)7(15)4-20(8)3-6(14)10(18)5(13)1-9(16)17/h5-8,10-15,18-19H,1-4H2 |
| InChIKey | GBPPPZCNERRIAG-UHFFFAOYSA-N |
| XLogP | -5.08 |
| TPSA | 161.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | -5.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|