C8H16O6S — CID 141247628
S-ethyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioate (PubChem CID 141247628) has the molecular formula C8H16O6S and a molecular weight of 240.28 g/mol. Its IUPAC name is S-ethyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioate.
| Compound Name | S-ethyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioate |
|---|---|
| PubChem CID | 141247628 |
| Molecular Formula | C8H16O6S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | S-ethyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioate |
| SMILES | CCSC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H16O6S/c1-2-15-8(14)7(13)6(12)5(11)4(10)3-9/h4-7,9-13H,2-3H2,1H3/t4-,5-,6+,7-/m1/s1 |
| InChIKey | YZFNYZCDYYRSSB-MVIOUDGNSA-N |
| XLogP | -2.30 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|