C7H12O7S2 — CID 54478981
[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]sulfanylmethanethioic S-acid (PubChem CID 54478981) has the molecular formula C7H12O7S2 and a molecular weight of 272.30 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]sulfanylmethanethioic S-acid.
| Compound Name | [(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]sulfanylmethanethioic S-acid |
|---|---|
| PubChem CID | 54478981 |
| Molecular Formula | C7H12O7S2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | [(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]sulfanylmethanethioic S-acid |
| SMILES | O=C(S)SC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H12O7S2/c8-1-2(9)3(10)4(11)5(12)6(13)16-7(14)15/h2-5,8-12H,1H2,(H,14,15)/t2-,3-,4+,5-/m1/s1 |
| InChIKey | XNQMYIOQVSENJX-SQOUGZDYSA-N |
| XLogP | -2.27 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|