C10H18O5S2 — CID 10858966
(3R,4R,5S)-5-[(1R)-2,2-bis(ethylsulfanyl)-1-hydroxyethyl]-3,4-dihydroxyoxolan-2-one (PubChem CID 10858966) has the molecular formula C10H18O5S2 and a molecular weight of 282.38 g/mol. Its IUPAC name is (3R,4R,5S)-5-[(1R)-2,2-bis(ethylsulfanyl)-1-hydroxyethyl]-3,4-dihydroxyoxolan-2-one.
| Compound Name | (3R,4R,5S)-5-[(1R)-2,2-bis(ethylsulfanyl)-1-hydroxyethyl]-3,4-dihydroxyoxolan-2-one |
|---|---|
| PubChem CID | 10858966 |
| Molecular Formula | C10H18O5S2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | (3R,4R,5S)-5-[(1R)-2,2-bis(ethylsulfanyl)-1-hydroxyethyl]-3,4-dihydroxyoxolan-2-one |
| SMILES | CCSC(SCC)[C@H](O)[C@H]1OC(=O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18O5S2/c1-3-16-10(17-4-2)7(13)8-5(11)6(12)9(14)15-8/h5-8,10-13H,3-4H2,1-2H3/t5-,6-,7-,8+/m1/s1 |
| InChIKey | SYEGUGGXUIEIMQ-XUTVFYLZSA-N |
| XLogP | -0.17 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|