C14H23NaO6S2 — CID 44511268
sodium (4S)-4-[(4S,5R)-5-[bis(ethylsulfanyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate (PubChem CID 44511268) has the molecular formula C14H23NaO6S2 and a molecular weight of 374.46 g/mol. Its IUPAC name is sodium (4S)-4-[(4S,5R)-5-[bis(ethylsulfanyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate.
| Compound Name | sodium (4S)-4-[(4S,5R)-5-[bis(ethylsulfanyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate |
|---|---|
| PubChem CID | 44511268 |
| Molecular Formula | C14H23NaO6S2 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | sodium (4S)-4-[(4S,5R)-5-[bis(ethylsulfanyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate |
| SMILES | CCSC(SCC)[C@@H]1OC(C)(C)O[C@H]1[C@@H](O)CC(=O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C14H24O6S2.Na/c1-5-21-13(22-6-2)11-10(19-14(3,4)20-11)8(15)7-9(16)12(17)18;/h8,10-11,13,15H,5-7H2,1-4H3,(H,17,18);/q;+1/p-1/t8-,10-,11+;/m0./s1 |
| InChIKey | CUXUDNYBQOULBK-LINSOWKESA-M |
| XLogP | -2.59 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|