C19H34O8S2 — CID 11123293
methyl (3R)-3-[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-bis(ethylsulfanyl)-3-hydroxypropanoate (PubChem CID 11123293) has the molecular formula C19H34O8S2 and a molecular weight of 454.61 g/mol. Its IUPAC name is methyl (3R)-3-[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-bis(ethylsulfanyl)-3-hydroxypropanoate.
| Compound Name | methyl (3R)-3-[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-bis(ethylsulfanyl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 11123293 |
| Molecular Formula | C19H34O8S2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | methyl (3R)-3-[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-bis(ethylsulfanyl)-3-hydroxypropanoate |
| SMILES | CCSC(SCC)(C(=O)OC)[C@H](O)[C@H]1OC(C)(C)O[C@H]1[C@H](O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C19H34O8S2/c1-8-28-19(29-9-2,16(22)23-7)15(21)14-13(26-18(5,6)27-14)12(20)11-10-24-17(3,4)25-11/h11-15,20-21H,8-10H2,1-7H3/t11-,12-,13+,14+,15-/m1/s1 |
| InChIKey | WOZRSZBUCCAVTA-NIFZNCRKSA-N |
| XLogP | 1.76 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|