C19H34O7S2 — CID 14701333
methyl 3-[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-bis(ethylsulfanyl)propanoate (PubChem CID 14701333) has the molecular formula C19H34O7S2 and a molecular weight of 438.61 g/mol. Its IUPAC name is methyl 3-[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-bis(ethylsulfanyl)propanoate.
| Compound Name | methyl 3-[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-bis(ethylsulfanyl)propanoate |
|---|---|
| PubChem CID | 14701333 |
| Molecular Formula | C19H34O7S2 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | methyl 3-[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-bis(ethylsulfanyl)propanoate |
| SMILES | CCSC(C[C@H]1OC(C)(C)O[C@H]1[C@H](O)[C@H]1COC(C)(C)O1)(SCC)C(=O)OC |
| InChI | InChI=1S/C19H34O7S2/c1-8-27-19(28-9-2,16(21)22-7)10-12-15(26-18(5,6)24-12)14(20)13-11-23-17(3,4)25-13/h12-15,20H,8-11H2,1-7H3/t12-,13-,14-,15-/m1/s1 |
| InChIKey | AJHYUIGHKPVZGG-KBUPBQIOSA-N |
| XLogP | 2.78 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|