C23H44O5S — CID 91721680
[(2R,3R,4S,5S)-3,4-dihydroxy-5-octylsulfanyloxolan-2-yl]methyl decanoate (PubChem CID 91721680) has the molecular formula C23H44O5S and a molecular weight of 432.67 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-3,4-dihydroxy-5-octylsulfanyloxolan-2-yl]methyl decanoate.
| Compound Name | [(2R,3R,4S,5S)-3,4-dihydroxy-5-octylsulfanyloxolan-2-yl]methyl decanoate |
|---|---|
| PubChem CID | 91721680 |
| Molecular Formula | C23H44O5S |
| Molecular Weight | 432.67 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | [(2R,3R,4S,5S)-3,4-dihydroxy-5-octylsulfanyloxolan-2-yl]methyl decanoate |
| SMILES | CCCCCCCCCC(=O)OC[C@H]1O[C@@H](SCCCCCCCC)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C23H44O5S/c1-3-5-7-9-11-12-14-16-20(24)27-18-19-21(25)22(26)23(28-19)29-17-15-13-10-8-6-4-2/h19,21-23,25-26H,3-18H2,1-2H3/t19-,21+,22+,23+/m1/s1 |
| InChIKey | LPHJTXCAJKXXHE-SWUCNREESA-N |
| XLogP | 5.21 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.67 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|