C16H30O5S — CID 537841
1-(3,4-dihydroxy-5-octylsulfanyloxolan-2-yl)ethyl acetate (PubChem CID 537841) has the molecular formula C16H30O5S and a molecular weight of 334.48 g/mol. Its IUPAC name is 1-(3,4-dihydroxy-5-octylsulfanyloxolan-2-yl)ethyl acetate.
| Compound Name | 1-(3,4-dihydroxy-5-octylsulfanyloxolan-2-yl)ethyl acetate |
|---|---|
| PubChem CID | 537841 |
| Molecular Formula | C16H30O5S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 1-(3,4-dihydroxy-5-octylsulfanyloxolan-2-yl)ethyl acetate |
| SMILES | CCCCCCCCSC1OC(C(C)OC(C)=O)C(O)C1O |
| InChI | InChI=1S/C16H30O5S/c1-4-5-6-7-8-9-10-22-16-14(19)13(18)15(21-16)11(2)20-12(3)17/h11,13-16,18-19H,4-10H2,1-3H3 |
| InChIKey | VPKCLFMJOYTHNZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|