C10H18O7S — CID 91032709
methyl 3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropanoate (PubChem CID 91032709) has the molecular formula C10H18O7S and a molecular weight of 282.31 g/mol. Its IUPAC name is methyl 3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropanoate.
| Compound Name | methyl 3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 91032709 |
| Molecular Formula | C10H18O7S |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | methyl 3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropanoate |
| SMILES | COC(=O)CCS[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18O7S/c1-16-6(12)2-3-18-10-9(15)8(14)7(13)5(4-11)17-10/h5,7-11,13-15H,2-4H2,1H3/t5-,7-,8+,9-,10+/m1/s1 |
| InChIKey | UIDSGXVWYINELE-HOQQJHGQSA-N |
| XLogP | -1.92 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |