C18H34O5S — CID 559070
(3,4-dihydroxy-5-octylsulfanyloxolan-2-yl)methyl pentanoate (PubChem CID 559070) has the molecular formula C18H34O5S and a molecular weight of 362.53 g/mol. Its IUPAC name is (3,4-dihydroxy-5-octylsulfanyloxolan-2-yl)methyl pentanoate.
| Compound Name | (3,4-dihydroxy-5-octylsulfanyloxolan-2-yl)methyl pentanoate |
|---|---|
| PubChem CID | 559070 |
| Molecular Formula | C18H34O5S |
| Molecular Weight | 362.53 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (3,4-dihydroxy-5-octylsulfanyloxolan-2-yl)methyl pentanoate |
| SMILES | CCCCCCCCSC1OC(COC(=O)CCCC)C(O)C1O |
| InChI | InChI=1S/C18H34O5S/c1-3-5-7-8-9-10-12-24-18-17(21)16(20)14(23-18)13-22-15(19)11-6-4-2/h14,16-18,20-21H,3-13H2,1-2H3 |
| InChIKey | RKKOZPPBRSJSCL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|