C16H26O6S2 — CID 100928127
(5R)-5-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-bis(methylsulfanyl)oxolan-2-one (PubChem CID 100928127) has the molecular formula C16H26O6S2 and a molecular weight of 378.51 g/mol. Its IUPAC name is (5R)-5-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-bis(methylsulfanyl)oxolan-2-one.
| Compound Name | (5R)-5-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-bis(methylsulfanyl)oxolan-2-one |
|---|---|
| PubChem CID | 100928127 |
| Molecular Formula | C16H26O6S2 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (5R)-5-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-bis(methylsulfanyl)oxolan-2-one |
| SMILES | CSC1(SC)C[C@H]([C@@H]2OC(C)(C)O[C@@H]2[C@H]2COC(C)(C)O2)OC1=O |
| InChI | InChI=1S/C16H26O6S2/c1-14(2)18-8-10(20-14)12-11(21-15(3,4)22-12)9-7-16(23-5,24-6)13(17)19-9/h9-12H,7-8H2,1-6H3/t9-,10-,11+,12-/m1/s1 |
| InChIKey | BUNUXKFSSUPSMH-WISYIIOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|