C16H22O7S2 — CID 25242043
[(3aS,6R,6aS)-2,2-dimethyl-6-[(3R)-1-oxo-2-oxa-6,10-dithiaspiro[4.5]decan-3-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate (PubChem CID 25242043) has the molecular formula C16H22O7S2 and a molecular weight of 390.48 g/mol. Its IUPAC name is [(3aS,6R,6aS)-2,2-dimethyl-6-[(3R)-1-oxo-2-oxa-6,10-dithiaspiro[4.5]decan-3-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate.
| Compound Name | [(3aS,6R,6aS)-2,2-dimethyl-6-[(3R)-1-oxo-2-oxa-6,10-dithiaspiro[4.5]decan-3-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate |
|---|---|
| PubChem CID | 25242043 |
| Molecular Formula | C16H22O7S2 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | [(3aS,6R,6aS)-2,2-dimethyl-6-[(3R)-1-oxo-2-oxa-6,10-dithiaspiro[4.5]decan-3-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate |
| SMILES | CC(=O)OC1O[C@H]([C@H]2CC3(SCCCS3)C(=O)O2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C16H22O7S2/c1-8(17)19-13-12-11(22-15(2,3)23-12)10(21-13)9-7-16(14(18)20-9)24-5-4-6-25-16/h9-13H,4-7H2,1-3H3/t9-,10-,11+,12+,13?/m1/s1 |
| InChIKey | ONOVFLSXUVIBHG-BWOQGFTMSA-N |
| XLogP | 1.68 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |