C25H36O13S — CID 100986361
[(2R,3S,4R,5S,6R)-6-[3-[(3aS,4S,6S,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3-oxopropyl]-3,4,5-triacetyloxythian-2-yl]methyl acetate (PubChem CID 100986361) has the molecular formula C25H36O13S and a molecular weight of 576.62 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6R)-6-[3-[(3aS,4S,6S,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3-oxopropyl]-3,4,5-triacetyloxythian-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6R)-6-[3-[(3aS,4S,6S,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3-oxopropyl]-3,4,5-triacetyloxythian-2-yl]methyl acetate |
|---|---|
| PubChem CID | 100986361 |
| Molecular Formula | C25H36O13S |
| Molecular Weight | 576.62 g/mol |
| Exact Mass | 576.19 |
| IUPAC Name | [(2R,3S,4R,5S,6R)-6-[3-[(3aS,4S,6S,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3-oxopropyl]-3,4,5-triacetyloxythian-2-yl]methyl acetate |
| SMILES | CO[C@H]1O[C@H](C(=O)CC[C@H]2S[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]2OC(C)=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C25H36O13S/c1-11(26)32-10-17-20(34-13(3)28)21(35-14(4)29)19(33-12(2)27)16(39-17)9-8-15(30)18-22-23(24(31-7)36-18)38-25(5,6)37-22/h16-24H,8-10H2,1-7H3/t16-,17-,18-,19-,20-,21-,22+,23+,24+/m1/s1 |
| InChIKey | NNKBALSTHMQGQH-YPYCETJPSA-N |
| XLogP | 1.07 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.62 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|