C21H30O13S — CID 177494990
methyl (2R,4S,5R,6R)-4,5-diacetyloxy-6-[(1S,2S)-1,2-diacetyloxy-3-acetylsulfanylpropyl]-2-methoxyoxane-2-carboxylate (PubChem CID 177494990) has the molecular formula C21H30O13S and a molecular weight of 522.53 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-4,5-diacetyloxy-6-[(1S,2S)-1,2-diacetyloxy-3-acetylsulfanylpropyl]-2-methoxyoxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-4,5-diacetyloxy-6-[(1S,2S)-1,2-diacetyloxy-3-acetylsulfanylpropyl]-2-methoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 177494990 |
| Molecular Formula | C21H30O13S |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | methyl (2R,4S,5R,6R)-4,5-diacetyloxy-6-[(1S,2S)-1,2-diacetyloxy-3-acetylsulfanylpropyl]-2-methoxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(OC)C[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]([C@H](OC(C)=O)[C@@H](CSC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C21H30O13S/c1-10(22)30-15-8-21(29-7,20(27)28-6)34-19(17(15)32-12(3)24)18(33-13(4)25)16(31-11(2)23)9-35-14(5)26/h15-19H,8-9H2,1-7H3/t15-,16+,17+,18+,19+,21+/m0/s1 |
| InChIKey | SRTQYVDKQJLYHE-YKFXCJJJSA-N |
| XLogP | 0.30 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|