C16H26O6S2 — CID 134937182
[(4S,5S)-5-[(R)-(2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-(1,3-dithian-2-yl)methanone (PubChem CID 134937182) has the molecular formula C16H26O6S2 and a molecular weight of 378.51 g/mol. Its IUPAC name is [(4S,5S)-5-[(R)-(2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-(1,3-dithian-2-yl)methanone.
| Compound Name | [(4S,5S)-5-[(R)-(2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-(1,3-dithian-2-yl)methanone |
|---|---|
| PubChem CID | 134937182 |
| Molecular Formula | C16H26O6S2 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | [(4S,5S)-5-[(R)-(2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-(1,3-dithian-2-yl)methanone |
| SMILES | CC1(C)OCC([C@@H](O)[C@@H]2OC(C)(C)O[C@@H]2C(=O)C2SCCCS2)O1 |
| InChI | InChI=1S/C16H26O6S2/c1-15(2)19-8-9(20-15)10(17)12-13(22-16(3,4)21-12)11(18)14-23-6-5-7-24-14/h9-10,12-14,17H,5-8H2,1-4H3/t9?,10-,12+,13-/m1/s1 |
| InChIKey | DYSKRQRHEOFDJW-AABPYCQOSA-N |
| XLogP | 1.78 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |